C13H18F2N2O — CID 82088956
1-[2-(2,4-difluorophenoxy)ethyl]-1,4-diazepane (PubChem CID 82088956) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-1,4-diazepane.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 82088956 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-1,4-diazepane |
| SMILES | Fc1ccc(OCCN2CCCNCC2)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c14-11-2-3-13(12(15)10-11)18-9-8-17-6-1-4-16-5-7-17/h2-3,10,16H,1,4-9H2 |
| InChIKey | HGPZGQDZJKLDGK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |