C15H24N2O2 — CID 43162465
1-[2-(4-ethoxyphenoxy)ethyl]-1,4-diazepane (PubChem CID 43162465) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[2-(4-ethoxyphenoxy)ethyl]-1,4-diazepane.
| Compound Name | 1-[2-(4-ethoxyphenoxy)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 43162465 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-[2-(4-ethoxyphenoxy)ethyl]-1,4-diazepane |
| SMILES | CCOc1ccc(OCCN2CCCNCC2)cc1 |
| InChI | InChI=1S/C15H24N2O2/c1-2-18-14-4-6-15(7-5-14)19-13-12-17-10-3-8-16-9-11-17/h4-7,16H,2-3,8-13H2,1H3 |
| InChIKey | FSVDAIGMJCLVBQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |