C16H27ClN2O2 — CID 119909159
[1-[2-(2-ethoxyphenoxy)ethyl]piperidin-4-yl]methanamine;hydrochloride (PubChem CID 119909159) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is [1-[2-(2-ethoxyphenoxy)ethyl]piperidin-4-yl]methanamine;hydrochloride.
| Compound Name | [1-[2-(2-ethoxyphenoxy)ethyl]piperidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119909159 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | [1-[2-(2-ethoxyphenoxy)ethyl]piperidin-4-yl]methanamine;hydrochloride |
| SMILES | CCOc1ccccc1OCCN1CCC(CN)CC1.Cl |
| InChI | InChI=1S/C16H26N2O2.ClH/c1-2-19-15-5-3-4-6-16(15)20-12-11-18-9-7-14(13-17)8-10-18;/h3-6,14H,2,7-13,17H2,1H3;1H |
| InChIKey | AFFKGEHNZFSVOJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |