C11H15BrO2 — CID 10539183
4-(2-bromoethoxy)-2,3,6-trimethylphenol (PubChem CID 10539183) has the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. Its IUPAC name is 4-(2-bromoethoxy)-2,3,6-trimethylphenol.
| Compound Name | 4-(2-bromoethoxy)-2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 10539183 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4-(2-bromoethoxy)-2,3,6-trimethylphenol |
| SMILES | Cc1cc(OCCBr)c(C)c(C)c1O |
| InChI | InChI=1S/C11H15BrO2/c1-7-6-10(14-5-4-12)8(2)9(3)11(7)13/h6,13H,4-5H2,1-3H3 |
| InChIKey | JJJWFUGJDADEOM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|