C23H26O2Si — CID 159530954
4-(benzhydrylsilylmethoxy)-2,3,6-trimethylphenol (PubChem CID 159530954) has the molecular formula C23H26O2Si and a molecular weight of 362.55 g/mol. Its IUPAC name is 4-(benzhydrylsilylmethoxy)-2,3,6-trimethylphenol.
| Compound Name | 4-(benzhydrylsilylmethoxy)-2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 159530954 |
| Molecular Formula | C23H26O2Si |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-(benzhydrylsilylmethoxy)-2,3,6-trimethylphenol |
| SMILES | Cc1cc(OC[SiH2]C(c2ccccc2)c2ccccc2)c(C)c(C)c1O |
| InChI | InChI=1S/C23H26O2Si/c1-16-14-21(17(2)18(3)22(16)24)25-15-26-23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-14,23-24H,15,26H2,1-3H3 |
| InChIKey | MCZIWRXODIKMQK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|