C16H26O3 — CID 10659422
4-(7-hydroxyheptoxy)-2,3,6-trimethylphenol (PubChem CID 10659422) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-(7-hydroxyheptoxy)-2,3,6-trimethylphenol.
| Compound Name | 4-(7-hydroxyheptoxy)-2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 10659422 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4-(7-hydroxyheptoxy)-2,3,6-trimethylphenol |
| SMILES | Cc1cc(OCCCCCCCO)c(C)c(C)c1O |
| InChI | InChI=1S/C16H26O3/c1-12-11-15(13(2)14(3)16(12)18)19-10-8-6-4-5-7-9-17/h11,17-18H,4-10H2,1-3H3 |
| InChIKey | GJNBJDISZMFFTP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|