C16H25BrO3 — CID 139840535
4-[5-(2-bromoethoxy)pentoxy]-2,3,6-trimethylphenol (PubChem CID 139840535) has the molecular formula C16H25BrO3 and a molecular weight of 345.28 g/mol. Its IUPAC name is 4-[5-(2-bromoethoxy)pentoxy]-2,3,6-trimethylphenol.
| Compound Name | 4-[5-(2-bromoethoxy)pentoxy]-2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 139840535 |
| Molecular Formula | C16H25BrO3 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4-[5-(2-bromoethoxy)pentoxy]-2,3,6-trimethylphenol |
| SMILES | Cc1cc(OCCCCCOCCBr)c(C)c(C)c1O |
| InChI | InChI=1S/C16H25BrO3/c1-12-11-15(13(2)14(3)16(12)18)20-9-6-4-5-8-19-10-7-17/h11,18H,4-10H2,1-3H3 |
| InChIKey | SYEFCTDHFNQYPO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|