C29H30O2 — CID 59746015
4-[(4-hydroxy-2,3,5-trimethylphenyl)-naphthalen-1-ylmethyl]-2,3,6-trimethylphenol (PubChem CID 59746015) has the molecular formula C29H30O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 4-[(4-hydroxy-2,3,5-trimethylphenyl)-naphthalen-1-ylmethyl]-2,3,6-trimethylphenol.
| Compound Name | 4-[(4-hydroxy-2,3,5-trimethylphenyl)-naphthalen-1-ylmethyl]-2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 59746015 |
| Molecular Formula | C29H30O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 4-[(4-hydroxy-2,3,5-trimethylphenyl)-naphthalen-1-ylmethyl]-2,3,6-trimethylphenol |
| SMILES | Cc1cc(C(c2cc(C)c(O)c(C)c2C)c2cccc3ccccc23)c(C)c(C)c1O |
| InChI | InChI=1S/C29H30O2/c1-16-14-25(18(3)20(5)28(16)30)27(26-15-17(2)29(31)21(6)19(26)4)24-13-9-11-22-10-7-8-12-23(22)24/h7-15,27,30-31H,1-6H3 |
| InChIKey | XYSILXLXXBKBLM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|