C19H30N2O3 — CID 139690584
[2,3,6-trimethyl-4-(4-piperazin-1-ylbutoxy)phenyl] acetate (PubChem CID 139690584) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is [2,3,6-trimethyl-4-(4-piperazin-1-ylbutoxy)phenyl] acetate.
| Compound Name | [2,3,6-trimethyl-4-(4-piperazin-1-ylbutoxy)phenyl] acetate |
|---|---|
| PubChem CID | 139690584 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | [2,3,6-trimethyl-4-(4-piperazin-1-ylbutoxy)phenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(OCCCCN2CCNCC2)c(C)c1C |
| InChI | InChI=1S/C19H30N2O3/c1-14-13-18(15(2)16(3)19(14)24-17(4)22)23-12-6-5-9-21-10-7-20-8-11-21/h13,20H,5-12H2,1-4H3 |
| InChIKey | DZEFMXNIBRBRLK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|