C27H37N3O4 — CID 139690589
[4-[4-[4-(2-acetamidophenyl)piperazin-1-yl]butoxy]-2,3,6-trimethylphenyl] acetate (PubChem CID 139690589) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is [4-[4-[4-(2-acetamidophenyl)piperazin-1-yl]butoxy]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[4-[4-(2-acetamidophenyl)piperazin-1-yl]butoxy]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 139690589 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | [4-[4-[4-(2-acetamidophenyl)piperazin-1-yl]butoxy]-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Nc1ccccc1N1CCN(CCCCOc2cc(C)c(OC(C)=O)c(C)c2C)CC1 |
| InChI | InChI=1S/C27H37N3O4/c1-19-18-26(20(2)21(3)27(19)34-23(5)32)33-17-9-8-12-29-13-15-30(16-14-29)25-11-7-6-10-24(25)28-22(4)31/h6-7,10-11,18H,8-9,12-17H2,1-5H3,(H,28,31) |
| InChIKey | SXFIDKFUEDVSKU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|