C23H30N2O5 — CID 139690579
methyl 4-hydroxy-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]benzoate (PubChem CID 139690579) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is methyl 4-hydroxy-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]benzoate.
| Compound Name | methyl 4-hydroxy-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]benzoate |
|---|---|
| PubChem CID | 139690579 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl 4-hydroxy-2-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]benzoate |
| SMILES | COC(=O)c1ccc(O)cc1OCCCCN1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H30N2O5/c1-28-21-8-4-3-7-20(21)25-14-12-24(13-15-25)11-5-6-16-30-22-17-18(26)9-10-19(22)23(27)29-2/h3-4,7-10,17,26H,5-6,11-16H2,1-2H3 |
| InChIKey | SKEHMOKHAANPBS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|