C21H27N3O4 — CID 44538760
[4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethoxy]phenyl]methyl carbamate (PubChem CID 44538760) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is [4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethoxy]phenyl]methyl carbamate.
| Compound Name | [4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethoxy]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 44538760 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethoxy]phenyl]methyl carbamate |
| SMILES | COc1ccccc1N1CCN(CCOc2ccc(COC(N)=O)cc2)CC1 |
| InChI | InChI=1S/C21H27N3O4/c1-26-20-5-3-2-4-19(20)24-12-10-23(11-13-24)14-15-27-18-8-6-17(7-9-18)16-28-21(22)25/h2-9H,10-16H2,1H3,(H2,22,25) |
| InChIKey | ADNARUGQVWHIQY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |