C24H32N6O2 — CID 44538353
1-(2-methoxyphenyl)-4-[4-[4-[(5-methyltetrazol-1-yl)methyl]phenoxy]butyl]piperazine (PubChem CID 44538353) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[4-[4-[(5-methyltetrazol-1-yl)methyl]phenoxy]butyl]piperazine.
| Compound Name | 1-(2-methoxyphenyl)-4-[4-[4-[(5-methyltetrazol-1-yl)methyl]phenoxy]butyl]piperazine |
|---|---|
| PubChem CID | 44538353 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[4-[4-[(5-methyltetrazol-1-yl)methyl]phenoxy]butyl]piperazine |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc(Cn3nnnc3C)cc2)CC1 |
| InChI | InChI=1S/C24H32N6O2/c1-20-25-26-27-30(20)19-21-9-11-22(12-10-21)32-18-6-5-13-28-14-16-29(17-15-28)23-7-3-4-8-24(23)31-2/h3-4,7-12H,5-6,13-19H2,1-2H3 |
| InChIKey | CSLLMZCPBKRCNG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|