C24H34N6O2 — CID 143901767
1-[4-[4-[2-(1,3-dihydrotetrazol-2-yl)ethyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 143901767) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-[4-[4-[2-(1,3-dihydrotetrazol-2-yl)ethyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[4-[4-[2-(1,3-dihydrotetrazol-2-yl)ethyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 143901767 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-[4-[4-[2-(1,3-dihydrotetrazol-2-yl)ethyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc(CCN3NC=NN3)cc2)CC1 |
| InChI | InChI=1S/C24H34N6O2/c1-31-24-7-3-2-6-23(24)29-17-15-28(16-18-29)13-4-5-19-32-22-10-8-21(9-11-22)12-14-30-26-20-25-27-30/h2-3,6-11,20,27H,4-5,12-19H2,1H3,(H,25,26) |
| InChIKey | DHJIQJZELRLGIE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|