C25H32N4O2S — CID 58269751
2-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-1,3,4-thiadiazole (PubChem CID 58269751) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is 2-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-1,3,4-thiadiazole.
| Compound Name | 2-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58269751 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-1,3,4-thiadiazole |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc(CCc3nncs3)cc2)CC1 |
| InChI | InChI=1S/C25H32N4O2S/c1-30-24-7-3-2-6-23(24)29-17-15-28(16-18-29)14-4-5-19-31-22-11-8-21(9-12-22)10-13-25-27-26-20-32-25/h2-3,6-9,11-12,20H,4-5,10,13-19H2,1H3 |
| InChIKey | RJVMGGAMJCMCCP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|