C24H35N5O2 — CID 143901770
N-amino-N-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]methanimidamide (PubChem CID 143901770) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-amino-N-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]methanimidamide.
| Compound Name | N-amino-N-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]methanimidamide |
|---|---|
| PubChem CID | 143901770 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | N-amino-N-[2-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]methanimidamide |
| SMILES | [H]/N=C/N(N)CCc1ccc(OCCCCN2CCN(c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C24H35N5O2/c1-30-24-7-3-2-6-23(24)28-17-15-27(16-18-28)13-4-5-19-31-22-10-8-21(9-11-22)12-14-29(26)20-25/h2-3,6-11,20,25H,4-5,12-19,26H2,1H3/b25-20+ |
| InChIKey | YCJGHIMFNINQSS-LKUDQCMESA-N |
| XLogP | 3.00 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|