C25H34N6O2 — CID 66909941
1-(2-methoxyphenyl)-4-[4-[4-[2-(5-methyltetrazol-5-yl)ethyl]phenoxy]butyl]piperazine (PubChem CID 66909941) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[4-[4-[2-(5-methyltetrazol-5-yl)ethyl]phenoxy]butyl]piperazine.
| Compound Name | 1-(2-methoxyphenyl)-4-[4-[4-[2-(5-methyltetrazol-5-yl)ethyl]phenoxy]butyl]piperazine |
|---|---|
| PubChem CID | 66909941 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[4-[4-[2-(5-methyltetrazol-5-yl)ethyl]phenoxy]butyl]piperazine |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc(CCC3(C)N=NN=N3)cc2)CC1 |
| InChI | InChI=1S/C25H34N6O2/c1-25(26-28-29-27-25)14-13-21-9-11-22(12-10-21)33-20-6-5-15-30-16-18-31(19-17-30)23-7-3-4-8-24(23)32-2/h3-4,7-12H,5-6,13-20H2,1-2H3 |
| InChIKey | XATJKQJEYBVFNU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|