C22H27IN4O2 — CID 25072630
3-iodo-5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine (PubChem CID 25072630) has the molecular formula C22H27IN4O2 and a molecular weight of 506.39 g/mol. Its IUPAC name is 3-iodo-5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine.
| Compound Name | 3-iodo-5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 25072630 |
| Molecular Formula | C22H27IN4O2 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 3-iodo-5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccn3ncc(I)c3c2)CC1 |
| InChI | InChI=1S/C22H27IN4O2/c1-28-22-7-3-2-6-20(22)26-13-11-25(12-14-26)9-4-5-15-29-18-8-10-27-21(16-18)19(23)17-24-27/h2-3,6-8,10,16-17H,4-5,9,11-15H2,1H3 |
| InChIKey | AHBNGAKWHSHWTB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|