C26H35N5O2 — CID 163901494
1-[[3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-6-methyl-4H-triazine (PubChem CID 163901494) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[[3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-6-methyl-4H-triazine.
| Compound Name | 1-[[3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-6-methyl-4H-triazine |
|---|---|
| PubChem CID | 163901494 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 1-[[3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-6-methyl-4H-triazine |
| SMILES | COc1ccccc1N1CCN(CCCCOc2cccc(CN3N=NCC=C3C)c2)CC1 |
| InChI | InChI=1S/C26H35N5O2/c1-22-12-13-27-28-31(22)21-23-8-7-9-24(20-23)33-19-6-5-14-29-15-17-30(18-16-29)25-10-3-4-11-26(25)32-2/h3-4,7-12,20H,5-6,13-19,21H2,1-2H3 |
| InChIKey | QKGHYMVEHBLNEV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|