C25H30Cl2N4O2 — CID 44538453
1-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 44538453) has the molecular formula C25H30Cl2N4O2 and a molecular weight of 489.45 g/mol. Its IUPAC name is 1-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 44538453 |
| Molecular Formula | C25H30Cl2N4O2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 1-[4-[4-[(4,5-dichloroimidazol-1-yl)methyl]phenoxy]butyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc(Cn3cnc(Cl)c3Cl)cc2)CC1 |
| InChI | InChI=1S/C25H30Cl2N4O2/c1-32-23-7-3-2-6-22(23)30-15-13-29(14-16-30)12-4-5-17-33-21-10-8-20(9-11-21)18-31-19-28-24(26)25(31)27/h2-3,6-11,19H,4-5,12-18H2,1H3 |
| InChIKey | RJMGVVDGDWBNIQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|