C25H36N4O3 — CID 44538852
3-[[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-1,1-dimethylurea (PubChem CID 44538852) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 3-[[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 44538852 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 3-[[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]-1,1-dimethylurea |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc(CNC(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H36N4O3/c1-27(2)25(30)26-20-21-10-12-22(13-11-21)32-19-7-6-14-28-15-17-29(18-16-28)23-8-4-5-9-24(23)31-3/h4-5,8-13H,6-7,14-20H2,1-3H3,(H,26,30) |
| InChIKey | REIMJCRSYDEDLR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|