C26H37N3O3 — CID 139749928
N-[[4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]methyl]pentanamide (PubChem CID 139749928) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[[4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]methyl]pentanamide.
| Compound Name | N-[[4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 139749928 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | N-[[4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1ccc(OCCCN2CCN(c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C26H37N3O3/c1-3-4-10-26(30)27-21-22-11-13-23(14-12-22)32-20-7-15-28-16-18-29(19-17-28)24-8-5-6-9-25(24)31-2/h5-6,8-9,11-14H,3-4,7,10,15-21H2,1-2H3,(H,27,30) |
| InChIKey | DGUUPONXWHYOQV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|