C23H27ClN4O3 — CID 68716440
methyl 5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 68716440) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is methyl 5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | methyl 5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68716440 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | methyl 5-[4-[4-(2-chlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnn2ccc(OCCCCN3CCN(c4ccccc4Cl)CC3)cc12 |
| InChI | InChI=1S/C23H27ClN4O3/c1-30-23(29)19-17-25-28-10-8-18(16-22(19)28)31-15-5-4-9-26-11-13-27(14-12-26)21-7-3-2-6-20(21)24/h2-3,6-8,10,16-17H,4-5,9,11-15H2,1H3 |
| InChIKey | VTBMVBZCJIIPJO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|