C22H28N4O2 — CID 25071067
5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine (PubChem CID 25071067) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine.
| Compound Name | 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 25071067 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
| SMILES | COc1ccc(N2CCN(CCCCOc3ccn4nccc4c3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O2/c1-27-21-6-4-19(5-7-21)25-15-13-24(14-16-25)11-2-3-17-28-22-9-12-26-20(18-22)8-10-23-26/h4-10,12,18H,2-3,11,13-17H2,1H3 |
| InChIKey | NNGAHSYQGXPHNL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|