C31H36N6O2 — CID 19894595
4-[4-[6-(4-methoxyphenoxy)hexyl]piperazin-1-yl]-2,6-dipyridin-2-ylpyrimidine (PubChem CID 19894595) has the molecular formula C31H36N6O2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 4-[4-[6-(4-methoxyphenoxy)hexyl]piperazin-1-yl]-2,6-dipyridin-2-ylpyrimidine.
| Compound Name | 4-[4-[6-(4-methoxyphenoxy)hexyl]piperazin-1-yl]-2,6-dipyridin-2-ylpyrimidine |
|---|---|
| PubChem CID | 19894595 |
| Molecular Formula | C31H36N6O2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 4-[4-[6-(4-methoxyphenoxy)hexyl]piperazin-1-yl]-2,6-dipyridin-2-ylpyrimidine |
| SMILES | COc1ccc(OCCCCCCN2CCN(c3cc(-c4ccccn4)nc(-c4ccccn4)n3)CC2)cc1 |
| InChI | InChI=1S/C31H36N6O2/c1-38-25-12-14-26(15-13-25)39-23-9-3-2-8-18-36-19-21-37(22-20-36)30-24-29(27-10-4-6-16-32-27)34-31(35-30)28-11-5-7-17-33-28/h4-7,10-17,24H,2-3,8-9,18-23H2,1H3 |
| InChIKey | FZIPRZFVLNCYEY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|