C14H22ClN3 — CID 61288750
1-(5-chloropentyl)-4-pyridin-2-ylpiperazine (PubChem CID 61288750) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 1-(5-chloropentyl)-4-pyridin-2-ylpiperazine.
| Compound Name | 1-(5-chloropentyl)-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 61288750 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-(5-chloropentyl)-4-pyridin-2-ylpiperazine |
| SMILES | ClCCCCCN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C14H22ClN3/c15-7-3-1-5-9-17-10-12-18(13-11-17)14-6-2-4-8-16-14/h2,4,6,8H,1,3,5,7,9-13H2 |
| InChIKey | OIYPOUYTGQOSRZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|