C38H48N8O4 — CID 10652152
4,10-bis[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 10652152) has the molecular formula C38H48N8O4 and a molecular weight of 680.85 g/mol. Its IUPAC name is 4,10-bis[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | 4,10-bis[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 10652152 |
| Molecular Formula | C38H48N8O4 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.38 |
| IUPAC Name | 4,10-bis[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | O=C1C2C3C=CC(C2C(=O)N1CCCCN1CCN(c2ccccn2)CC1)C1C(=O)N(CCCCN2CCN(c4ccccn4)CC2)C(=O)C31 |
| InChI | InChI=1S/C38H48N8O4/c47-35-31-27-11-12-28(32(31)36(48)45(35)17-7-5-15-41-19-23-43(24-20-41)29-9-1-3-13-39-29)34-33(27)37(49)46(38(34)50)18-8-6-16-42-21-25-44(26-22-42)30-10-2-4-14-40-30/h1-4,9-14,27-28,31-34H,5-8,15-26H2 |
| InChIKey | URPVRRCGZUHGDM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|