C25H34N4O4 — CID 101143897
(1R,2R,6R,7S)-1-ethoxy-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 101143897) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is (1R,2R,6R,7S)-1-ethoxy-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | (1R,2R,6R,7S)-1-ethoxy-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 101143897 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (1R,2R,6R,7S)-1-ethoxy-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | CCO[C@]12CC[C@H](C(=O)C1)[C@H]1C(=O)N(CCCCN3CCN(c4ccccn4)CC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C25H34N4O4/c1-2-33-25-9-8-18(19(30)17-25)21-22(25)24(32)29(23(21)31)12-6-5-11-27-13-15-28(16-14-27)20-7-3-4-10-26-20/h3-4,7,10,18,21-22H,2,5-6,8-9,11-17H2,1H3/t18-,21-,22+,25-/m1/s1 |
| InChIKey | DFUVLNIPGCUQSB-LLHPUKMZSA-N |
| XLogP | 1.74 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|