C18H26ClN5O2 — CID 23315265
3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-azabicyclo[3.2.0]heptane-2,4-dione;hydrochloride (PubChem CID 23315265) has the molecular formula C18H26ClN5O2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-azabicyclo[3.2.0]heptane-2,4-dione;hydrochloride.
| Compound Name | 3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-azabicyclo[3.2.0]heptane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 23315265 |
| Molecular Formula | C18H26ClN5O2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-azabicyclo[3.2.0]heptane-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1C2CCC2C(=O)N1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H25N5O2.ClH/c24-16-14-4-5-15(14)17(25)23(16)9-2-1-8-21-10-12-22(13-11-21)18-19-6-3-7-20-18;/h3,6-7,14-15H,1-2,4-5,8-13H2;1H |
| InChIKey | PONBGGUMVUOWEJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|