C13H20N4O2 — CID 28972374
5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid (PubChem CID 28972374) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid.
| Compound Name | 5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 28972374 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid |
| SMILES | O=C(O)CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H20N4O2/c18-12(19)4-1-2-7-16-8-10-17(11-9-16)13-14-5-3-6-15-13/h3,5-6H,1-2,4,7-11H2,(H,18,19) |
| InChIKey | NLIOPUFPIZKEGF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|