C22H28N4O3 — CID 14423695
4-oxo-4-[4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]phenyl]butanoic acid (PubChem CID 14423695) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-oxo-4-[4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]phenyl]butanoic acid.
| Compound Name | 4-oxo-4-[4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 14423695 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 4-oxo-4-[4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc(CCCCN2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c27-20(9-10-21(28)29)19-7-5-18(6-8-19)4-1-2-13-25-14-16-26(17-15-25)22-23-11-3-12-24-22/h3,5-8,11-12H,1-2,4,9-10,13-17H2,(H,28,29) |
| InChIKey | KTQOKWVFRHLBJC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|