C24H32N4O3 — CID 139661151
4-hydroxyimino-4-[4-[4-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]butyl]phenyl]butanoic acid (PubChem CID 139661151) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-hydroxyimino-4-[4-[4-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]butyl]phenyl]butanoic acid.
| Compound Name | 4-hydroxyimino-4-[4-[4-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]butyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 139661151 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 4-hydroxyimino-4-[4-[4-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]butyl]phenyl]butanoic acid |
| SMILES | Cc1cccc(N2CCN(CCCCc3ccc(C(CCC(=O)O)=NO)cc3)CC2)n1 |
| InChI | InChI=1S/C24H32N4O3/c1-19-5-4-7-23(25-19)28-17-15-27(16-18-28)14-3-2-6-20-8-10-21(11-9-20)22(26-31)12-13-24(29)30/h4-5,7-11,31H,2-3,6,12-18H2,1H3,(H,29,30) |
| InChIKey | LXMARZUJKMCKBJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|