C24H29ClN2O3 — CID 14423689
4-[4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]phenyl]-4-oxobutanoic acid (PubChem CID 14423689) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is 4-[4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14423689 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 4-[4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]phenyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc(CCCCN2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C24H29ClN2O3/c25-21-5-3-6-22(18-21)27-16-14-26(15-17-27)13-2-1-4-19-7-9-20(10-8-19)23(28)11-12-24(29)30/h3,5-10,18H,1-2,4,11-17H2,(H,29,30) |
| InChIKey | LFEXJOZXXZIDRX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|