C25H35ClN2O — CID 69351262
1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-8-phenyloctan-3-ol (PubChem CID 69351262) has the molecular formula C25H35ClN2O and a molecular weight of 415.02 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-8-phenyloctan-3-ol.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-8-phenyloctan-3-ol |
|---|---|
| PubChem CID | 69351262 |
| Molecular Formula | C25H35ClN2O |
| Molecular Weight | 415.02 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-8-phenyloctan-3-ol |
| SMILES | CC(CCCCc1ccccc1)C(O)CCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H35ClN2O/c1-21(8-5-6-11-22-9-3-2-4-10-22)25(29)14-15-27-16-18-28(19-17-27)24-13-7-12-23(26)20-24/h2-4,7,9-10,12-13,20-21,25,29H,5-6,8,11,14-19H2,1H3 |
| InChIKey | UEGYKWXSJNGFFA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|