C27H36ClN5O — CID 13369924
2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-(4-phenylbutyl)-1,2,4-triazol-3-one (PubChem CID 13369924) has the molecular formula C27H36ClN5O and a molecular weight of 482.07 g/mol. Its IUPAC name is 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-(4-phenylbutyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-(4-phenylbutyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 13369924 |
| Molecular Formula | C27H36ClN5O |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-(4-phenylbutyl)-1,2,4-triazol-3-one |
| SMILES | CCc1nn(CCCN2CCN(c3cccc(Cl)c3)CC2)c(=O)n1CCCCc1ccccc1 |
| InChI | InChI=1S/C27H36ClN5O/c1-2-26-29-33(27(34)32(26)16-7-6-12-23-10-4-3-5-11-23)17-9-15-30-18-20-31(21-19-30)25-14-8-13-24(28)22-25/h3-5,8,10-11,13-14,22H,2,6-7,9,12,15-21H2,1H3 |
| InChIKey | HWGDHNSCQRKXAK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|