C25H29ClN4O — CID 70275794
2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-methyl-6-phenylpyridazin-3-one (PubChem CID 70275794) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-methyl-6-phenylpyridazin-3-one.
| Compound Name | 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-methyl-6-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 70275794 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-methyl-6-phenylpyridazin-3-one |
| SMILES | Cc1cc(-c2ccccc2)nn(CCCCN2CCN(c3cccc(Cl)c3)CC2)c1=O |
| InChI | InChI=1S/C25H29ClN4O/c1-20-18-24(21-8-3-2-4-9-21)27-30(25(20)31)13-6-5-12-28-14-16-29(17-15-28)23-11-7-10-22(26)19-23/h2-4,7-11,18-19H,5-6,12-17H2,1H3 |
| InChIKey | JQSILUAQMKKYOR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|