C25H29ClN4 — CID 11633155
N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine (PubChem CID 11633155) has the molecular formula C25H29ClN4 and a molecular weight of 420.99 g/mol. Its IUPAC name is N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine.
| Compound Name | N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 11633155 |
| Molecular Formula | C25H29ClN4 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine |
| SMILES | Clc1cccc(N2CCN(CCCCNc3cc(-c4ccccc4)ccn3)CC2)c1 |
| InChI | InChI=1S/C25H29ClN4/c26-23-9-6-10-24(20-23)30-17-15-29(16-18-30)14-5-4-12-27-25-19-22(11-13-28-25)21-7-2-1-3-8-21/h1-3,6-11,13,19-20H,4-5,12,14-18H2,(H,27,28) |
| InChIKey | PWJYDHPJSHWGIQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|