C27H32Cl2N4 — CID 69245717
N-[4-[4-[3-(dichloromethyl)phenyl]piperazin-1-yl]butyl]-4-(2-methylphenyl)pyridin-2-amine (PubChem CID 69245717) has the molecular formula C27H32Cl2N4 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-[4-[4-[3-(dichloromethyl)phenyl]piperazin-1-yl]butyl]-4-(2-methylphenyl)pyridin-2-amine.
| Compound Name | N-[4-[4-[3-(dichloromethyl)phenyl]piperazin-1-yl]butyl]-4-(2-methylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 69245717 |
| Molecular Formula | C27H32Cl2N4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[4-[4-[3-(dichloromethyl)phenyl]piperazin-1-yl]butyl]-4-(2-methylphenyl)pyridin-2-amine |
| SMILES | Cc1ccccc1-c1ccnc(NCCCCN2CCN(c3cccc(C(Cl)Cl)c3)CC2)c1 |
| InChI | InChI=1S/C27H32Cl2N4/c1-21-7-2-3-10-25(21)22-11-13-31-26(20-22)30-12-4-5-14-32-15-17-33(18-16-32)24-9-6-8-23(19-24)27(28)29/h2-3,6-11,13,19-20,27H,4-5,12,14-18H2,1H3,(H,30,31) |
| InChIKey | OAPXLADPGVUJHW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|