C18H24ClN5 — CID 53491181
2-chloro-6-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrimidin-4-amine (PubChem CID 53491181) has the molecular formula C18H24ClN5 and a molecular weight of 345.88 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 53491181 |
| Molecular Formula | C18H24ClN5 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-chloro-6-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrimidin-4-amine |
| SMILES | Cc1cc(NCCCN2CCN(c3ccccc3)CC2)nc(Cl)n1 |
| InChI | InChI=1S/C18H24ClN5/c1-15-14-17(22-18(19)21-15)20-8-5-9-23-10-12-24(13-11-23)16-6-3-2-4-7-16/h2-4,6-7,14H,5,8-13H2,1H3,(H,20,21,22) |
| InChIKey | VJTYKPDMGFEMCO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|