C18H24N4O2 — CID 3565841
2-[4-methyl-6-(3-morpholin-4-ylpropylamino)pyrimidin-2-yl]phenol (PubChem CID 3565841) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[4-methyl-6-(3-morpholin-4-ylpropylamino)pyrimidin-2-yl]phenol.
| Compound Name | 2-[4-methyl-6-(3-morpholin-4-ylpropylamino)pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 3565841 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-[4-methyl-6-(3-morpholin-4-ylpropylamino)pyrimidin-2-yl]phenol |
| SMILES | Cc1cc(NCCCN2CCOCC2)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-14-13-17(19-7-4-8-22-9-11-24-12-10-22)21-18(20-14)15-5-2-3-6-16(15)23/h2-3,5-6,13,23H,4,7-12H2,1H3,(H,19,20,21) |
| InChIKey | MDVRXUVWGVVRJT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|