C19H23F3N4O2 — CID 117080926
6-methyl-N-(3-morpholin-4-ylpropyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 117080926) has the molecular formula C19H23F3N4O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 6-methyl-N-(3-morpholin-4-ylpropyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(3-morpholin-4-ylpropyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 117080926 |
| Molecular Formula | C19H23F3N4O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 6-methyl-N-(3-morpholin-4-ylpropyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | Cc1cc(NCCCN2CCOCC2)nc(-c2cccc(OC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H23F3N4O2/c1-14-12-17(23-6-3-7-26-8-10-27-11-9-26)25-18(24-14)15-4-2-5-16(13-15)28-19(20,21)22/h2,4-5,12-13H,3,6-11H2,1H3,(H,23,24,25) |
| InChIKey | AGIRKXPENXSSJI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|