C29H31N5O — CID 3599041
6-[5-(4-methylphenyl)-3-pyridinyl]-N-(3-morpholin-4-ylpropyl)-2-phenylpyrimidin-4-amine (PubChem CID 3599041) has the molecular formula C29H31N5O and a molecular weight of 465.60 g/mol. Its IUPAC name is 6-[5-(4-methylphenyl)-3-pyridinyl]-N-(3-morpholin-4-ylpropyl)-2-phenylpyrimidin-4-amine.
| Compound Name | 6-[5-(4-methylphenyl)-3-pyridinyl]-N-(3-morpholin-4-ylpropyl)-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 3599041 |
| Molecular Formula | C29H31N5O |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 6-[5-(4-methylphenyl)-3-pyridinyl]-N-(3-morpholin-4-ylpropyl)-2-phenylpyrimidin-4-amine |
| SMILES | Cc1ccc(-c2cncc(-c3cc(NCCCN4CCOCC4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C29H31N5O/c1-22-8-10-23(11-9-22)25-18-26(21-30-20-25)27-19-28(31-12-5-13-34-14-16-35-17-15-34)33-29(32-27)24-6-3-2-4-7-24/h2-4,6-11,18-21H,5,12-17H2,1H3,(H,31,32,33) |
| InChIKey | VFBTZRQCVXTMHZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|