C17H23N5O — CID 4998539
2-methyl-N-(3-morpholin-4-ylpropyl)-6-pyridin-3-ylpyrimidin-4-amine (PubChem CID 4998539) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-methyl-N-(3-morpholin-4-ylpropyl)-6-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | 2-methyl-N-(3-morpholin-4-ylpropyl)-6-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 4998539 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-methyl-N-(3-morpholin-4-ylpropyl)-6-pyridin-3-ylpyrimidin-4-amine |
| SMILES | Cc1nc(NCCCN2CCOCC2)cc(-c2cccnc2)n1 |
| InChI | InChI=1S/C17H23N5O/c1-14-20-16(15-4-2-5-18-13-15)12-17(21-14)19-6-3-7-22-8-10-23-11-9-22/h2,4-5,12-13H,3,6-11H2,1H3,(H,19,20,21) |
| InChIKey | GBJBJFWGIVUBQL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|