C20H23N7O3 — CID 122294216
N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-pyridin-3-yl-1,2-oxazole-3-carboxamide (PubChem CID 122294216) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-pyridin-3-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-pyridin-3-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122294216 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-pyridin-3-yl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2cc(-c3cccnc3)on2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H23N7O3/c1-14-24-18(12-19(25-14)27-7-9-29-10-8-27)22-5-6-23-20(28)16-11-17(30-26-16)15-3-2-4-21-13-15/h2-4,11-13H,5-10H2,1H3,(H,23,28)(H,22,24,25) |
| InChIKey | GUBOXNMAOZRXLJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|