C19H22F3N5O2 — CID 50946507
N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 50946507) has the molecular formula C19H22F3N5O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 50946507 |
| Molecular Formula | C19H22F3N5O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1nc(NCCNC(=O)c2ccccc2C(F)(F)F)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H22F3N5O2/c1-13-25-16(12-17(26-13)27-8-10-29-11-9-27)23-6-7-24-18(28)14-4-2-3-5-15(14)19(20,21)22/h2-5,12H,6-11H2,1H3,(H,24,28)(H,23,25,26) |
| InChIKey | FOZRZTDVJYYRJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|