C17H23N5O2S — CID 122294149
4-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-carboxamide (PubChem CID 122294149) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-carboxamide.
| Compound Name | 4-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122294149 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NCCNc2cc(N3CCOCC3)nc(C)n2)c1 |
| InChI | InChI=1S/C17H23N5O2S/c1-12-9-14(25-11-12)17(23)19-4-3-18-15-10-16(21-13(2)20-15)22-5-7-24-8-6-22/h9-11H,3-8H2,1-2H3,(H,19,23)(H,18,20,21) |
| InChIKey | QPALDJUBQXVZMK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|