C21H24N6O3 — CID 118877205
N-[3-[(2-morpholin-4-ylpyrimidin-4-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 118877205) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[3-[(2-morpholin-4-ylpyrimidin-4-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[(2-morpholin-4-ylpyrimidin-4-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118877205 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[3-[(2-morpholin-4-ylpyrimidin-4-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCNc1ccnc(N2CCOCC2)n1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C21H24N6O3/c28-20(17-15-18(30-26-17)16-5-2-1-3-6-16)23-9-4-8-22-19-7-10-24-21(25-19)27-11-13-29-14-12-27/h1-3,5-7,10,15H,4,8-9,11-14H2,(H,23,28)(H,22,24,25) |
| InChIKey | GFDYVSUGPMVBEE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|