C13H14ClN3O2 — CID 118906505
N-[3-(chloroamino)propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 118906505) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is N-[3-(chloroamino)propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(chloroamino)propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118906505 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-[3-(chloroamino)propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCNCl)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C13H14ClN3O2/c14-16-8-4-7-15-13(18)11-9-12(19-17-11)10-5-2-1-3-6-10/h1-3,5-6,9,16H,4,7-8H2,(H,15,18) |
| InChIKey | JMLGCRUDJVRAQD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|