C19H17FN2O2 — CID 91954603
N-[3-(3-fluorophenyl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 91954603) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[3-(3-fluorophenyl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(3-fluorophenyl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91954603 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[3-(3-fluorophenyl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCc1cccc(F)c1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C19H17FN2O2/c20-16-10-4-6-14(12-16)7-5-11-21-19(23)17-13-18(24-22-17)15-8-2-1-3-9-15/h1-4,6,8-10,12-13H,5,7,11H2,(H,21,23) |
| InChIKey | GPGCAMYBMOIPAK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|