C20H21N3O4S — CID 110619652
N-[3-[4-(methanesulfonamido)phenyl]propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 110619652) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[3-[4-(methanesulfonamido)phenyl]propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[4-(methanesulfonamido)phenyl]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 110619652 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[3-[4-(methanesulfonamido)phenyl]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(CCCNC(=O)c2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-28(25,26)23-17-11-9-15(10-12-17)6-5-13-21-20(24)18-14-19(27-22-18)16-7-3-2-4-8-16/h2-4,7-12,14,23H,5-6,13H2,1H3,(H,21,24) |
| InChIKey | KDQPUTOTMSTTCS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|